C22H19Cl4NO — CID 86581645
(3E,5E)-3,5-bis[(2,3-dichlorophenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 86581645) has the molecular formula C22H19Cl4NO and a molecular weight of 455.21 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(2,3-dichlorophenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(2,3-dichlorophenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 86581645 |
| Molecular Formula | C22H19Cl4NO |
| Molecular Weight | 455.21 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | (3E,5E)-3,5-bis[(2,3-dichlorophenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1C/C(=C\c2cccc(Cl)c2Cl)C(=O)/C(=C/c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C22H19Cl4NO/c1-2-9-27-12-16(10-14-5-3-7-18(23)20(14)25)22(28)17(13-27)11-15-6-4-8-19(24)21(15)26/h3-8,10-11H,2,9,12-13H2,1H3/b16-10+,17-11+ |
| InChIKey | SFDAGWQGWLMSQR-OTYYAQKOSA-N |
| XLogP | 7.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.21 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|