C25H39NO3 — CID 110532362
(3E)-3-[(3-ethoxy-4-nonoxyphenyl)methylidene]-1-ethylpiperidin-4-one (PubChem CID 110532362) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is (3E)-3-[(3-ethoxy-4-nonoxyphenyl)methylidene]-1-ethylpiperidin-4-one.
| Compound Name | (3E)-3-[(3-ethoxy-4-nonoxyphenyl)methylidene]-1-ethylpiperidin-4-one |
|---|---|
| PubChem CID | 110532362 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (3E)-3-[(3-ethoxy-4-nonoxyphenyl)methylidene]-1-ethylpiperidin-4-one |
| SMILES | CCCCCCCCCOc1ccc(/C=C2\CN(CC)CCC2=O)cc1OCC |
| InChI | InChI=1S/C25H39NO3/c1-4-7-8-9-10-11-12-17-29-24-14-13-21(19-25(24)28-6-3)18-22-20-26(5-2)16-15-23(22)27/h13-14,18-19H,4-12,15-17,20H2,1-3H3/b22-18+ |
| InChIKey | LERBTYBIFSKFJP-RELWKKBWSA-N |
| XLogP | 5.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|