C27H26N2O2 — CID 134130901
(2Z)-6-methoxy-2-[[4-(4-phenylpiperazin-1-yl)phenyl]methylidene]-3H-inden-1-one (PubChem CID 134130901) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2Z)-6-methoxy-2-[[4-(4-phenylpiperazin-1-yl)phenyl]methylidene]-3H-inden-1-one.
| Compound Name | (2Z)-6-methoxy-2-[[4-(4-phenylpiperazin-1-yl)phenyl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 134130901 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (2Z)-6-methoxy-2-[[4-(4-phenylpiperazin-1-yl)phenyl]methylidene]-3H-inden-1-one |
| SMILES | COc1ccc2c(c1)C(=O)/C(=C\c1ccc(N3CCN(c4ccccc4)CC3)cc1)C2 |
| InChI | InChI=1S/C27H26N2O2/c1-31-25-12-9-21-18-22(27(30)26(21)19-25)17-20-7-10-24(11-8-20)29-15-13-28(14-16-29)23-5-3-2-4-6-23/h2-12,17,19H,13-16,18H2,1H3/b22-17- |
| InChIKey | VNRDEUYRILMNKR-XLNRJJMWSA-N |
| XLogP | 4.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|