C23H20BrNO2 — CID 178159408
2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one bromide (PubChem CID 178159408) has the molecular formula C23H20BrNO2 and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one bromide.
| Compound Name | 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one bromide |
|---|---|
| PubChem CID | 178159408 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one bromide |
| SMILES | COc1ccc2c(c1)C(=O)C(=Cc1ccc[n+](Cc3ccccc3)c1)C2.[Br-] |
| InChI | InChI=1S/C23H20NO2.BrH/c1-26-21-10-9-19-13-20(23(25)22(19)14-21)12-18-8-5-11-24(16-18)15-17-6-3-2-4-7-17;/h2-12,14,16H,13,15H2,1H3;1H/q+1;/p-1 |
| InChIKey | IXONSMIGFAPBID-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|