C24H21BrFNO2 — CID 178159380
2-[[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one bromide (PubChem CID 178159380) has the molecular formula C24H21BrFNO2 and a molecular weight of 454.34 g/mol. Its IUPAC name is 2-[[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one bromide.
| Compound Name | 2-[[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one bromide |
|---|---|
| PubChem CID | 178159380 |
| Molecular Formula | C24H21BrFNO2 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-[[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-6-methoxy-3,4-dihydronaphthalen-1-one bromide |
| SMILES | COc1ccc2c(c1)CCC(=Cc1cc[n+](Cc3ccc(F)cc3)cc1)C2=O.[Br-] |
| InChI | InChI=1S/C24H21FNO2.BrH/c1-28-22-8-9-23-19(15-22)4-5-20(24(23)27)14-17-10-12-26(13-11-17)16-18-2-6-21(25)7-3-18;/h2-3,6-15H,4-5,16H2,1H3;1H/q+1;/p-1 |
| InChIKey | GANGOQZAXOANDF-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|