C23H20NO2+ — CID 178159409
2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one (PubChem CID 178159409) has the molecular formula C23H20NO2+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one.
| Compound Name | 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 178159409 |
| Molecular Formula | C23H20NO2+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[(1-benzylpyridin-1-ium-3-yl)methylidene]-6-methoxy-3H-inden-1-one |
| SMILES | COc1ccc2c(c1)C(=O)C(=Cc1ccc[n+](Cc3ccccc3)c1)C2 |
| InChI | InChI=1S/C23H20NO2/c1-26-21-10-9-19-13-20(23(25)22(19)14-21)12-18-8-5-11-24(16-18)15-17-6-3-2-4-7-17/h2-12,14,16H,13,15H2,1H3/q+1 |
| InChIKey | KHICDQKPFLCPOX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|