C24H21BrNO3+ — CID 176732032
2-[[1-[(3-bromophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-5,6-dimethoxy-3H-inden-1-one (PubChem CID 176732032) has the molecular formula C24H21BrNO3+ and a molecular weight of 451.34 g/mol. Its IUPAC name is 2-[[1-[(3-bromophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-5,6-dimethoxy-3H-inden-1-one.
| Compound Name | 2-[[1-[(3-bromophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 176732032 |
| Molecular Formula | C24H21BrNO3+ |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-[[1-[(3-bromophenyl)methyl]pyridin-1-ium-4-yl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=Cc1cc[n+](Cc3cccc(Br)c3)cc1)C2 |
| InChI | InChI=1S/C24H21BrNO3/c1-28-22-13-18-12-19(24(27)21(18)14-23(22)29-2)10-16-6-8-26(9-7-16)15-17-4-3-5-20(25)11-17/h3-11,13-14H,12,15H2,1-2H3/q+1 |
| InChIKey | VNHHOROPXPPNCP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|