C30H32Br2N2O3 — CID 172655130
2-[[4-[4-[(4-bromophenyl)methyl]-1-methylpiperazin-1-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one bromide (PubChem CID 172655130) has the molecular formula C30H32Br2N2O3 and a molecular weight of 628.41 g/mol. Its IUPAC name is 2-[[4-[4-[(4-bromophenyl)methyl]-1-methylpiperazin-1-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one bromide.
| Compound Name | 2-[[4-[4-[(4-bromophenyl)methyl]-1-methylpiperazin-1-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one bromide |
|---|---|
| PubChem CID | 172655130 |
| Molecular Formula | C30H32Br2N2O3 |
| Molecular Weight | 628.41 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 2-[[4-[4-[(4-bromophenyl)methyl]-1-methylpiperazin-1-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one bromide |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=Cc1ccc([N+]3(C)CCN(Cc4ccc(Br)cc4)CC3)cc1)C2.[Br-] |
| InChI | InChI=1S/C30H32BrN2O3.BrH/c1-33(14-12-32(13-15-33)20-22-4-8-25(31)9-5-22)26-10-6-21(7-11-26)16-24-17-23-18-28(35-2)29(36-3)19-27(23)30(24)34;/h4-11,16,18-19H,12-15,17,20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CFLXFOWUQZZNGS-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|