C30H32ClN2O3+ — CID 176732475
2-[[4-[4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one (PubChem CID 176732475) has the molecular formula C30H32ClN2O3+ and a molecular weight of 504.05 g/mol. Its IUPAC name is 2-[[4-[4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one.
| Compound Name | 2-[[4-[4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 176732475 |
| Molecular Formula | C30H32ClN2O3+ |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-[[4-[4-[(2-chlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=Cc1ccc(N3CC[N+](C)(Cc4ccccc4Cl)CC3)cc1)C2 |
| InChI | InChI=1S/C30H32ClN2O3/c1-33(20-22-6-4-5-7-27(22)31)14-12-32(13-15-33)25-10-8-21(9-11-25)16-24-17-23-18-28(35-2)29(36-3)19-26(23)30(24)34/h4-11,16,18-19H,12-15,17,20H2,1-3H3/q+1 |
| InChIKey | GBKGLHSRAMRDHC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|