C22H22N2O3 — CID 171349206
(6E)-6-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one (PubChem CID 171349206) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (6E)-6-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one.
| Compound Name | (6E)-6-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
|---|---|
| PubChem CID | 171349206 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (6E)-6-[[4-(4-methylpiperazin-1-yl)phenyl]methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
| SMILES | CN1CCN(c2ccc(/C=C3\Cc4cc5c(cc4C3=O)OCO5)cc2)CC1 |
| InChI | InChI=1S/C22H22N2O3/c1-23-6-8-24(9-7-23)18-4-2-15(3-5-18)10-17-11-16-12-20-21(27-14-26-20)13-19(16)22(17)25/h2-5,10,12-13H,6-9,11,14H2,1H3/b17-10+ |
| InChIKey | IQUPCCJNTZOMPD-LICLKQGHSA-N |
| XLogP | 2.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|