C27H26N2O5 — CID 134142133
(2E)-2-[[4-[4-(furan-3-carbonyl)piperazin-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one (PubChem CID 134142133) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (2E)-2-[[4-[4-(furan-3-carbonyl)piperazin-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one.
| Compound Name | (2E)-2-[[4-[4-(furan-3-carbonyl)piperazin-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 134142133 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2E)-2-[[4-[4-(furan-3-carbonyl)piperazin-1-yl]phenyl]methylidene]-5,6-dimethoxy-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C/c1ccc(N3CCN(C(=O)c4ccoc4)CC3)cc1)C2 |
| InChI | InChI=1S/C27H26N2O5/c1-32-24-15-20-14-21(26(30)23(20)16-25(24)33-2)13-18-3-5-22(6-4-18)28-8-10-29(11-9-28)27(31)19-7-12-34-17-19/h3-7,12-13,15-17H,8-11,14H2,1-2H3/b21-13+ |
| InChIKey | CLLAPNVNWRFKIB-FYJGNVAPSA-N |
| XLogP | 4.08 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|