C22H21NO4 — CID 60602406
(7E)-7-[(4-piperidin-1-ylphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 60602406) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (7E)-7-[(4-piperidin-1-ylphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one.
| Compound Name | (7E)-7-[(4-piperidin-1-ylphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
|---|---|
| PubChem CID | 60602406 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (7E)-7-[(4-piperidin-1-ylphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | O=C1/C(=C/c2ccc(N3CCCCC3)cc2)COc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C22H21NO4/c24-22-16(13-25-19-12-21-20(11-18(19)22)26-14-27-21)10-15-4-6-17(7-5-15)23-8-2-1-3-9-23/h4-7,10-12H,1-3,8-9,13-14H2/b16-10+ |
| InChIKey | SURFIIIZQQRGJZ-MHWRWJLKSA-N |
| XLogP | 4.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|