C17H11ClO5 — CID 60602664
(7E)-7-[(3-chloro-4-hydroxyphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 60602664) has the molecular formula C17H11ClO5 and a molecular weight of 330.72 g/mol. Its IUPAC name is (7E)-7-[(3-chloro-4-hydroxyphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one.
| Compound Name | (7E)-7-[(3-chloro-4-hydroxyphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
|---|---|
| PubChem CID | 60602664 |
| Molecular Formula | C17H11ClO5 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (7E)-7-[(3-chloro-4-hydroxyphenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(Cl)c2)COc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H11ClO5/c18-12-4-9(1-2-13(12)19)3-10-7-21-14-6-16-15(22-8-23-16)5-11(14)17(10)20/h1-6,19H,7-8H2/b10-3+ |
| InChIKey | IFWSXLARNYXWKI-XCVCLJGOSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|