C25H30N2O3 — CID 70684009
(2Z)-5-methoxy-6-(4-piperidin-1-ylbutoxy)-2-(pyridin-4-ylmethylidene)-3H-inden-1-one (PubChem CID 70684009) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2Z)-5-methoxy-6-(4-piperidin-1-ylbutoxy)-2-(pyridin-4-ylmethylidene)-3H-inden-1-one.
| Compound Name | (2Z)-5-methoxy-6-(4-piperidin-1-ylbutoxy)-2-(pyridin-4-ylmethylidene)-3H-inden-1-one |
|---|---|
| PubChem CID | 70684009 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2Z)-5-methoxy-6-(4-piperidin-1-ylbutoxy)-2-(pyridin-4-ylmethylidene)-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OCCCCN1CCCCC1)C(=O)/C(=C\c1ccncc1)C2 |
| InChI | InChI=1S/C25H30N2O3/c1-29-23-17-20-16-21(15-19-7-9-26-10-8-19)25(28)22(20)18-24(23)30-14-6-5-13-27-11-3-2-4-12-27/h7-10,15,17-18H,2-6,11-14,16H2,1H3/b21-15- |
| InChIKey | CGHRJPHPMNKBOD-QNGOZBTKSA-N |
| XLogP | 4.56 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|