C20H17F3O4 — CID 170562718
(2E)-5,6-dimethoxy-2-[[2-methoxy-5-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one (PubChem CID 170562718) has the molecular formula C20H17F3O4 and a molecular weight of 378.35 g/mol. Its IUPAC name is (2E)-5,6-dimethoxy-2-[[2-methoxy-5-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one.
| Compound Name | (2E)-5,6-dimethoxy-2-[[2-methoxy-5-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 170562718 |
| Molecular Formula | C20H17F3O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (2E)-5,6-dimethoxy-2-[[2-methoxy-5-(trifluoromethyl)phenyl]methylidene]-3H-inden-1-one |
| SMILES | COc1ccc(C(F)(F)F)cc1/C=C1\Cc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C20H17F3O4/c1-25-16-5-4-14(20(21,22)23)8-12(16)7-13-6-11-9-17(26-2)18(27-3)10-15(11)19(13)24/h4-5,7-10H,6H2,1-3H3/b13-7+ |
| InChIKey | JLEOJLJMKJNWOT-NTUHNPAUSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|