C22H19ClF3NO3 — CID 123563564
2-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-6-methoxy-5-morpholin-4-yl-3H-inden-1-one (PubChem CID 123563564) has the molecular formula C22H19ClF3NO3 and a molecular weight of 437.85 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-6-methoxy-5-morpholin-4-yl-3H-inden-1-one.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-6-methoxy-5-morpholin-4-yl-3H-inden-1-one |
|---|---|
| PubChem CID | 123563564 |
| Molecular Formula | C22H19ClF3NO3 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]methylidene]-6-methoxy-5-morpholin-4-yl-3H-inden-1-one |
| SMILES | COc1cc2c(cc1N1CCOCC1)CC(=Cc1cc(C(F)(F)F)ccc1Cl)C2=O |
| InChI | InChI=1S/C22H19ClF3NO3/c1-29-20-12-17-13(11-19(20)27-4-6-30-7-5-27)8-15(21(17)28)9-14-10-16(22(24,25)26)2-3-18(14)23/h2-3,9-12H,4-8H2,1H3 |
| InChIKey | UEQFNSJYUCWBTC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|