C21H22F3NO3S — CID 146510812
4-[7-methoxy-3-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2,1-benzoxathiin-6-yl]morpholine (PubChem CID 146510812) has the molecular formula C21H22F3NO3S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-[7-methoxy-3-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2,1-benzoxathiin-6-yl]morpholine.
| Compound Name | 4-[7-methoxy-3-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2,1-benzoxathiin-6-yl]morpholine |
|---|---|
| PubChem CID | 146510812 |
| Molecular Formula | C21H22F3NO3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[7-methoxy-3-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydro-2,1-benzoxathiin-6-yl]morpholine |
| SMILES | COc1cc2c(cc1N1CCOCC1)CC(Cc1ccc(C(F)(F)F)cc1)OS2 |
| InChI | InChI=1S/C21H22F3NO3S/c1-26-19-13-20-15(12-18(19)25-6-8-27-9-7-25)11-17(28-29-20)10-14-2-4-16(5-3-14)21(22,23)24/h2-5,12-13,17H,6-11H2,1H3 |
| InChIKey | NWDUVRBQSYLWNJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|