C21H17NO3 — CID 98199839
(2E)-5,6-dimethoxy-2-(quinolin-8-ylmethylidene)-3H-inden-1-one (PubChem CID 98199839) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2E)-5,6-dimethoxy-2-(quinolin-8-ylmethylidene)-3H-inden-1-one.
| Compound Name | (2E)-5,6-dimethoxy-2-(quinolin-8-ylmethylidene)-3H-inden-1-one |
|---|---|
| PubChem CID | 98199839 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2E)-5,6-dimethoxy-2-(quinolin-8-ylmethylidene)-3H-inden-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C/c1cccc3cccnc13)C2 |
| InChI | InChI=1S/C21H17NO3/c1-24-18-11-15-10-16(21(23)17(15)12-19(18)25-2)9-14-6-3-5-13-7-4-8-22-20(13)14/h3-9,11-12H,10H2,1-2H3/b16-9+ |
| InChIKey | YOECVYVSYQDGNP-CXUHLZMHSA-N |
| XLogP | 4.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|