C29H29N3O9 — CID 90819846
[(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] carbonate (PubChem CID 90819846) has the molecular formula C29H29N3O9 and a molecular weight of 563.56 g/mol. Its IUPAC name is [(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] carbonate.
| Compound Name | [(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] carbonate |
|---|---|
| PubChem CID | 90819846 |
| Molecular Formula | C29H29N3O9 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [(2S,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-1,3-dioxolan-2-yl]methyl [4-[(5,6-dimethoxy-3-oxo-1H-inden-2-ylidene)methyl]-2,6-dimethylphenyl] carbonate |
| SMILES | COc1cc2c(cc1OC)C(=O)C(=Cc1cc(C)c(OC(=O)OC[C@H]3OC[C@@H](n4ccc(N)nc4=O)O3)c(C)c1)C2 |
| InChI | InChI=1S/C29H29N3O9/c1-15-7-17(9-19-10-18-11-21(36-3)22(37-4)12-20(18)26(19)33)8-16(2)27(15)41-29(35)39-14-25-38-13-24(40-25)32-6-5-23(30)31-28(32)34/h5-9,11-12,24-25H,10,13-14H2,1-4H3,(H2,30,31,34)/t24-,25-/m0/s1 |
| InChIKey | QTIRMULSCJFMPK-DQEYMECFSA-N |
| XLogP | 3.37 |
| TPSA | 150.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|