C24H21N5O12 — CID 72634930
[4-[4-[(4-nitrophenyl)methoxycarbonylamino]-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl (4-nitrophenyl)methyl carbonate (PubChem CID 72634930) has the molecular formula C24H21N5O12 and a molecular weight of 571.46 g/mol. Its IUPAC name is [4-[4-[(4-nitrophenyl)methoxycarbonylamino]-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl (4-nitrophenyl)methyl carbonate.
| Compound Name | [4-[4-[(4-nitrophenyl)methoxycarbonylamino]-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl (4-nitrophenyl)methyl carbonate |
|---|---|
| PubChem CID | 72634930 |
| Molecular Formula | C24H21N5O12 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | [4-[4-[(4-nitrophenyl)methoxycarbonylamino]-2-oxopyrimidin-1-yl]-1,3-dioxolan-2-yl]methyl (4-nitrophenyl)methyl carbonate |
| SMILES | O=C(Nc1ccn(C2COC(COC(=O)OCc3ccc([N+](=O)[O-])cc3)O2)c(=O)n1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21N5O12/c30-22-25-19(26-23(31)38-11-15-1-5-17(6-2-15)28(33)34)9-10-27(22)20-13-37-21(41-20)14-40-24(32)39-12-16-3-7-18(8-4-16)29(35)36/h1-10,20-21H,11-14H2,(H,25,26,30,31) |
| InChIKey | UGALCRZDOBCNDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 213.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|