C11H13N3O6 — CID 142134209
ethyl N-[1-[(2S,4S)-2-formyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 142134209) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is ethyl N-[1-[(2S,4S)-2-formyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-[(2S,4S)-2-formyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142134209 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | ethyl N-[1-[(2S,4S)-2-formyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccn([C@@H]2CO[C@H](C=O)O2)c(=O)n1 |
| InChI | InChI=1S/C11H13N3O6/c1-2-18-11(17)13-7-3-4-14(10(16)12-7)8-6-19-9(5-15)20-8/h3-5,8-9H,2,6H2,1H3,(H,12,13,16,17)/t8-,9-/m0/s1 |
| InChIKey | FRBLHTDTRWCBPS-IUCAKERBSA-N |
| XLogP | -0.12 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|