C20H31N3O5 — CID 59035700
N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-pentylcyclohexane-1-carboxamide (PubChem CID 59035700) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-pentylcyclohexane-1-carboxamide.
| Compound Name | N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-pentylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59035700 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-pentylcyclohexane-1-carboxamide |
| SMILES | CCCCCC1CCC(C(=O)Nc2ccn([C@@H]3CO[C@H](CO)O3)c(=O)n2)CC1 |
| InChI | InChI=1S/C20H31N3O5/c1-2-3-4-5-14-6-8-15(9-7-14)19(25)21-16-10-11-23(20(26)22-16)17-13-27-18(12-24)28-17/h10-11,14-15,17-18,24H,2-9,12-13H2,1H3,(H,21,22,25,26)/t14?,15?,17-,18-/m0/s1 |
| InChIKey | VOHGNHJVHHKFEL-RLNQZENFSA-N |
| XLogP | 2.43 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|