C26H36N4O7 — CID 59035831
tert-butyl N-benzyl-N-[6-[[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]amino]-6-oxohexyl]carbamate (PubChem CID 59035831) has the molecular formula C26H36N4O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[6-[[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[6-[[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 59035831 |
| Molecular Formula | C26H36N4O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | tert-butyl N-benzyl-N-[6-[[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCC(=O)Nc1ccn([C@@H]2CO[C@H](CO)O2)c(=O)n1)Cc1ccccc1 |
| InChI | InChI=1S/C26H36N4O7/c1-26(2,3)37-25(34)29(16-19-10-6-4-7-11-19)14-9-5-8-12-21(32)27-20-13-15-30(24(33)28-20)22-18-35-23(17-31)36-22/h4,6-7,10-11,13,15,22-23,31H,5,8-9,12,14,16-18H2,1-3H3,(H,27,28,32,33)/t22-,23-/m0/s1 |
| InChIKey | UDRZCQKSYITGSI-GOTSBHOMSA-N |
| XLogP | 3.04 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|