C23H31N3O5 — CID 59035858
N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-2-methyl-8-phenyloctanamide (PubChem CID 59035858) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-2-methyl-8-phenyloctanamide.
| Compound Name | N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-2-methyl-8-phenyloctanamide |
|---|---|
| PubChem CID | 59035858 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-2-methyl-8-phenyloctanamide |
| SMILES | CC(CCCCCCc1ccccc1)C(=O)Nc1ccn([C@@H]2CO[C@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C23H31N3O5/c1-17(9-5-2-3-6-10-18-11-7-4-8-12-18)22(28)24-19-13-14-26(23(29)25-19)20-16-30-21(15-27)31-20/h4,7-8,11-14,17,20-21,27H,2-3,5-6,9-10,15-16H2,1H3,(H,24,25,28,29)/t17?,20-,21-/m0/s1 |
| InChIKey | STZUNAFLXSGWPV-FUKGKQRISA-N |
| XLogP | 2.87 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|