C14H14N4O7S — CID 142134274
N-[1-[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-nitrobenzenesulfonamide (PubChem CID 142134274) has the molecular formula C14H14N4O7S and a molecular weight of 382.35 g/mol. Its IUPAC name is N-[1-[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[1-[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 142134274 |
| Molecular Formula | C14H14N4O7S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[1-[(2S,4S)-2-methyl-1,3-dioxolan-4-yl]-2-oxopyrimidin-4-yl]-4-nitrobenzenesulfonamide |
| SMILES | C[C@H]1OC[C@@H](n2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)nc2=O)O1 |
| InChI | InChI=1S/C14H14N4O7S/c1-9-24-8-13(25-9)17-7-6-12(15-14(17)19)16-26(22,23)11-4-2-10(3-5-11)18(20)21/h2-7,9,13H,8H2,1H3,(H,15,16,19)/t9-,13-/m0/s1 |
| InChIKey | ZRLLVINRXISPKD-ZANVPECISA-N |
| XLogP | 0.84 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|