C13H20N3O4S+ — CID 4094615
N-(2,6-dimethylpiperidin-1-ium-1-yl)-4-nitrobenzenesulfonamide (PubChem CID 4094615) has the molecular formula C13H20N3O4S+ and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-ium-1-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(2,6-dimethylpiperidin-1-ium-1-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4094615 |
| Molecular Formula | C13H20N3O4S+ |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-ium-1-yl)-4-nitrobenzenesulfonamide |
| SMILES | CC1CCCC(C)[NH+]1NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H19N3O4S/c1-10-4-3-5-11(2)15(10)14-21(19,20)13-8-6-12(7-9-13)16(17)18/h6-11,14H,3-5H2,1-2H3/p+1 |
| InChIKey | VDTTVMJMGFSKMF-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|