C17H16F2N4O8 — CID 141461991
(4-nitrophenyl)methyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 141461991) has the molecular formula C17H16F2N4O8 and a molecular weight of 442.33 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 141461991 |
| Molecular Formula | C17H16F2N4O8 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | O=C(Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16F2N4O8/c18-17(19)13(25)11(7-24)31-14(17)22-6-5-12(20-15(22)26)21-16(27)30-8-9-1-3-10(4-2-9)23(28)29/h1-6,11,13-14,24-25H,7-8H2,(H,20,21,26,27)/t11-,13-,14-/m1/s1 |
| InChIKey | PMLAJIPNXDSCKZ-MRVWCRGKSA-N |
| XLogP | 0.79 |
| TPSA | 166.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|