C18H23F2N3O6 — CID 147423554
cyclooct-2-en-1-yl N-[1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 147423554) has the molecular formula C18H23F2N3O6 and a molecular weight of 415.39 g/mol. Its IUPAC name is cyclooct-2-en-1-yl N-[1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | cyclooct-2-en-1-yl N-[1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 147423554 |
| Molecular Formula | C18H23F2N3O6 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | cyclooct-2-en-1-yl N-[1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | O=C(Nc1ccn([C@@H]2O[C@H](CO)C(O)C2(F)F)c(=O)n1)OC1C=CCCCCC1 |
| InChI | InChI=1S/C18H23F2N3O6/c19-18(20)14(25)12(10-24)29-15(18)23-9-8-13(21-16(23)26)22-17(27)28-11-6-4-2-1-3-5-7-11/h4,6,8-9,11-12,14-15,24-25H,1-3,5,7,10H2,(H,21,22,26,27)/t11?,12-,14?,15-/m1/s1 |
| InChIKey | DSYQOIWRAZENCZ-HTLISINNSA-N |
| XLogP | 1.57 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|