C18H23F2N3O6 — CID 126700247
[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl [(2E)-cyclooct-2-en-1-yl] carbonate (PubChem CID 126700247) has the molecular formula C18H23F2N3O6 and a molecular weight of 415.39 g/mol. Its IUPAC name is [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl [(2E)-cyclooct-2-en-1-yl] carbonate.
| Compound Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl [(2E)-cyclooct-2-en-1-yl] carbonate |
|---|---|
| PubChem CID | 126700247 |
| Molecular Formula | C18H23F2N3O6 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl [(2E)-cyclooct-2-en-1-yl] carbonate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COC(=O)OC3/C=C\CCCCC3)C(O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C18H23F2N3O6/c19-18(20)14(24)12(29-15(18)23-9-8-13(21)22-16(23)25)10-27-17(26)28-11-6-4-2-1-3-5-7-11/h4,6,8-9,11-12,14-15,24H,1-3,5,7,10H2,(H2,21,22,25)/b6-4-/t11?,12-,14?,15-/m1/s1 |
| InChIKey | ORHFSTKRUYPYRV-HYGSOWRDSA-N |
| XLogP | 1.76 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|