C18H15Cl3N4O9S — CID 86696176
(4-nitrophenyl) [(2R,5S)-5-[2-oxo-4-(2,2,2-trichloroethoxycarbonylamino)pyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl carbonate (PubChem CID 86696176) has the molecular formula C18H15Cl3N4O9S and a molecular weight of 569.76 g/mol. Its IUPAC name is (4-nitrophenyl) [(2R,5S)-5-[2-oxo-4-(2,2,2-trichloroethoxycarbonylamino)pyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl carbonate.
| Compound Name | (4-nitrophenyl) [(2R,5S)-5-[2-oxo-4-(2,2,2-trichloroethoxycarbonylamino)pyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 86696176 |
| Molecular Formula | C18H15Cl3N4O9S |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 567.96 |
| IUPAC Name | (4-nitrophenyl) [(2R,5S)-5-[2-oxo-4-(2,2,2-trichloroethoxycarbonylamino)pyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl carbonate |
| SMILES | O=C(Nc1ccn([C@@H]2CS[C@H](COC(=O)Oc3ccc([N+](=O)[O-])cc3)O2)c(=O)n1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H15Cl3N4O9S/c19-18(20,21)9-32-16(27)23-12-5-6-24(15(26)22-12)13-8-35-14(34-13)7-31-17(28)33-11-3-1-10(2-4-11)25(29)30/h1-6,13-14H,7-9H2,(H,22,23,26,27)/t13-,14+/m0/s1 |
| InChIKey | OKMXPHGQNSUPKU-UONOGXRCSA-N |
| XLogP | 3.87 |
| TPSA | 161.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|