C23H25NO3 — CID 71451803
(2E)-2-[[4-(cyclohexylamino)phenyl]methylidene]-6-hydroxy-5-methoxy-3H-inden-1-one (PubChem CID 71451803) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2E)-2-[[4-(cyclohexylamino)phenyl]methylidene]-6-hydroxy-5-methoxy-3H-inden-1-one.
| Compound Name | (2E)-2-[[4-(cyclohexylamino)phenyl]methylidene]-6-hydroxy-5-methoxy-3H-inden-1-one |
|---|---|
| PubChem CID | 71451803 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2E)-2-[[4-(cyclohexylamino)phenyl]methylidene]-6-hydroxy-5-methoxy-3H-inden-1-one |
| SMILES | COc1cc2c(cc1O)C(=O)/C(=C/c1ccc(NC3CCCCC3)cc1)C2 |
| InChI | InChI=1S/C23H25NO3/c1-27-22-13-16-12-17(23(26)20(16)14-21(22)25)11-15-7-9-19(10-8-15)24-18-5-3-2-4-6-18/h7-11,13-14,18,24-25H,2-6,12H2,1H3/b17-11+ |
| InChIKey | LUHVLUQHKXVPSX-GZTJUZNOSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|