C20H14BrN3O3 — CID 4889056
2-[[2-[(4-bromophenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-(cyanomethyl)amino]acetonitrile (PubChem CID 4889056) has the molecular formula C20H14BrN3O3 and a molecular weight of 424.25 g/mol. Its IUPAC name is 2-[[2-[(4-bromophenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[2-[(4-bromophenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 4889056 |
| Molecular Formula | C20H14BrN3O3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-[[2-[(4-bromophenyl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)Cc1c(O)ccc2c1OC(=Cc1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C20H14BrN3O3/c21-14-3-1-13(2-4-14)11-18-19(26)15-5-6-17(25)16(20(15)27-18)12-24(9-7-22)10-8-23/h1-6,11,25H,9-10,12H2 |
| InChIKey | LZHRQTLZFDXMBA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|