C20H12O5 — CID 171141184
2-hydroxy-5-[(3-oxobenzo[g][1]benzofuran-2-ylidene)methyl]benzoic acid (PubChem CID 171141184) has the molecular formula C20H12O5 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-hydroxy-5-[(3-oxobenzo[g][1]benzofuran-2-ylidene)methyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(3-oxobenzo[g][1]benzofuran-2-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 171141184 |
| Molecular Formula | C20H12O5 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-hydroxy-5-[(3-oxobenzo[g][1]benzofuran-2-ylidene)methyl]benzoic acid |
| SMILES | O=C(O)c1cc(C=C2Oc3c(ccc4ccccc34)C2=O)ccc1O |
| InChI | InChI=1S/C20H12O5/c21-16-8-5-11(9-15(16)20(23)24)10-17-18(22)14-7-6-12-3-1-2-4-13(12)19(14)25-17/h1-10,21H,(H,23,24) |
| InChIKey | OHUSDBONLYALFG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|