C21H18O7 — CID 170184439
5-[(E)-[(3E)-3-[[3-(dihydroxymethyl)-4-hydroxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]-2-hydroxybenzoic acid (PubChem CID 170184439) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is 5-[(E)-[(3E)-3-[[3-(dihydroxymethyl)-4-hydroxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(E)-[(3E)-3-[[3-(dihydroxymethyl)-4-hydroxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 170184439 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 5-[(E)-[(3E)-3-[[3-(dihydroxymethyl)-4-hydroxyphenyl]methylidene]-2-oxocyclopentylidene]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C1/C(=C/c2ccc(O)c(C(=O)O)c2)CC/C1=C\c1ccc(O)c(C(O)O)c1 |
| InChI | InChI=1S/C21H18O7/c22-17-5-1-11(9-15(17)20(25)26)7-13-3-4-14(19(13)24)8-12-2-6-18(23)16(10-12)21(27)28/h1-2,5-10,20,22-23,25-26H,3-4H2,(H,27,28)/b13-7+,14-8+ |
| InChIKey | YXEYIJORFVCIBQ-FNCQTZNRSA-N |
| XLogP | 2.61 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|