C19H18O6 — CID 10308825
(2E)-5,6,7-trimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 10308825) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2E)-5,6,7-trimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-5,6,7-trimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10308825 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2E)-5,6,7-trimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | COc1ccc(/C=C2/Oc3c(cc(OC)c(OC)c3OC)C2=O)cc1 |
| InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)9-14-16(20)13-10-15(22-2)18(23-3)19(24-4)17(13)25-14/h5-10H,1-4H3/b14-9+ |
| InChIKey | ZASPGTWURWBKOB-NTEUORMPSA-N |
| XLogP | 3.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|