C20H21NO7 — CID 57391238
(2Z)-2-[(5-amino-2,4-dimethoxyphenyl)methylidene]-5,6,7-trimethoxy-1-benzofuran-3-one (PubChem CID 57391238) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is (2Z)-2-[(5-amino-2,4-dimethoxyphenyl)methylidene]-5,6,7-trimethoxy-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-amino-2,4-dimethoxyphenyl)methylidene]-5,6,7-trimethoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 57391238 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (2Z)-2-[(5-amino-2,4-dimethoxyphenyl)methylidene]-5,6,7-trimethoxy-1-benzofuran-3-one |
| SMILES | COc1cc(OC)c(/C=C2\Oc3c(cc(OC)c(OC)c3OC)C2=O)cc1N |
| InChI | InChI=1S/C20H21NO7/c1-23-13-9-14(24-2)12(21)6-10(13)7-15-17(22)11-8-16(25-3)19(26-4)20(27-5)18(11)28-15/h6-9H,21H2,1-5H3/b15-7- |
| InChIKey | ONCCVDGZMDSXEM-CHHVJCJISA-N |
| XLogP | 2.93 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|