C22H22O8 — CID 7001734
methyl (2S)-2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]propanoate (PubChem CID 7001734) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is methyl (2S)-2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]propanoate.
| Compound Name | methyl (2S)-2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]propanoate |
|---|---|
| PubChem CID | 7001734 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl (2S)-2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1ccc2c(c1)OC(=Cc1cc(OC)c(OC)cc1OC)C2=O |
| InChI | InChI=1S/C22H22O8/c1-12(22(24)28-5)29-14-6-7-15-17(10-14)30-20(21(15)23)9-13-8-18(26-3)19(27-4)11-16(13)25-2/h6-12H,1-5H3/t12-/m0/s1 |
| InChIKey | GTUCFCOFWRJKAA-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|