C22H22O7 — CID 54026934
3-oxo-7-propyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-5-carboxylic acid (PubChem CID 54026934) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is 3-oxo-7-propyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-5-carboxylic acid.
| Compound Name | 3-oxo-7-propyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 54026934 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-oxo-7-propyl-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-5-carboxylic acid |
| SMILES | CCCc1cc(C(=O)O)cc2c1OC(=Cc1cc(OC)c(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C22H22O7/c1-5-6-13-10-14(22(24)25)11-15-19(23)16(29-20(13)15)7-12-8-17(26-2)21(28-4)18(9-12)27-3/h7-11H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | LCVOWQGBAUZUHA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|