C15H17NO5S — CID 72562648
3-ethyl-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazolidin-4-one (PubChem CID 72562648) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-ethyl-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazolidin-4-one.
| Compound Name | 3-ethyl-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 72562648 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-ethyl-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazolidin-4-one |
| SMILES | CCN1C(=O)C(=Cc2cc(OC)c(OC)c(OC)c2)OC1=S |
| InChI | InChI=1S/C15H17NO5S/c1-5-16-14(17)12(21-15(16)22)8-9-6-10(18-2)13(20-4)11(7-9)19-3/h6-8H,5H2,1-4H3 |
| InChIKey | WVHOUVFAJMKZFN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|