C18H17NO5S — CID 118375320
(5Z)-5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 118375320) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is (5Z)-5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 118375320 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (5Z)-5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2ccc(-c3ccc(OC)cc3OC)o2)OC1=S |
| InChI | InChI=1S/C18H17NO5S/c1-4-19-17(20)16(24-18(19)25)10-12-6-8-14(23-12)13-7-5-11(21-2)9-15(13)22-3/h5-10H,4H2,1-3H3/b16-10- |
| InChIKey | IHGBDMNYCYXJIZ-YBEGLDIGSA-N |
| XLogP | 3.47 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|