C23H18N2O6S2 — CID 87469021
2-[[5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid (PubChem CID 87469021) has the molecular formula C23H18N2O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[[5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid.
| Compound Name | 2-[[5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 87469021 |
| Molecular Formula | C23H18N2O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[[5-[[5-(2,4-dimethoxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
| SMILES | COc1ccc(-c2ccc(C=C3SC(=S)N(Nc4ccccc4C(=O)O)C3=O)o2)c(OC)c1 |
| InChI | InChI=1S/C23H18N2O6S2/c1-29-13-7-9-16(19(11-13)30-2)18-10-8-14(31-18)12-20-21(26)25(23(32)33-20)24-17-6-4-3-5-15(17)22(27)28/h3-12,24H,1-2H3,(H,27,28) |
| InChIKey | ZRRUKGLDXXXDHD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|