C23H17NO5S2 — CID 126206975
2-[5-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126206975) has the molecular formula C23H17NO5S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[5-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126206975 |
| Molecular Formula | C23H17NO5S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 2-[5-[(Z)-[3-(4-ethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccc(-c4ccccc4C(=O)O)o3)SC2=S)cc1 |
| InChI | InChI=1S/C23H17NO5S2/c1-2-28-15-9-7-14(8-10-15)24-21(25)20(31-23(24)30)13-16-11-12-19(29-16)17-5-3-4-6-18(17)22(26)27/h3-13H,2H2,1H3,(H,26,27)/b20-13- |
| InChIKey | IZOAUDFYPIRYMF-MOSHPQCFSA-N |
| XLogP | 5.45 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|