C22H16N2O5S2 — CID 91097338
2-[[5-[[5-[3-(hydroxymethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid (PubChem CID 91097338) has the molecular formula C22H16N2O5S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[5-[[5-[3-(hydroxymethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid.
| Compound Name | 2-[[5-[[5-[3-(hydroxymethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 91097338 |
| Molecular Formula | C22H16N2O5S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-[[5-[[5-[3-(hydroxymethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN1C(=O)C(=Cc2ccc(-c3cccc(CO)c3)o2)SC1=S |
| InChI | InChI=1S/C22H16N2O5S2/c25-12-13-4-3-5-14(10-13)18-9-8-15(29-18)11-19-20(26)24(22(30)31-19)23-17-7-2-1-6-16(17)21(27)28/h1-11,23,25H,12H2,(H,27,28) |
| InChIKey | BZGGVOJZWPKZHB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|