C21H13FN2O4S2 — CID 87469750
2-[[(5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid (PubChem CID 87469750) has the molecular formula C21H13FN2O4S2 and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-[[(5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid.
| Compound Name | 2-[[(5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 87469750 |
| Molecular Formula | C21H13FN2O4S2 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-[[(5E)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN1C(=O)/C(=C\c2ccc(-c3ccc(F)cc3)o2)SC1=S |
| InChI | InChI=1S/C21H13FN2O4S2/c22-13-7-5-12(6-8-13)17-10-9-14(28-17)11-18-19(25)24(21(29)30-18)23-16-4-2-1-3-15(16)20(26)27/h1-11,23H,(H,26,27)/b18-11+ |
| InChIKey | WQZZXQGHHJZQSV-WOJGMQOQSA-N |
| XLogP | 5.01 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|