C21H13N3O2S3 — CID 4710189
3-(1,3-benzothiazol-2-ylamino)-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4710189) has the molecular formula C21H13N3O2S3 and a molecular weight of 435.56 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylamino)-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4710189 |
| Molecular Formula | C21H13N3O2S3 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylamino)-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(-c3ccccc3)o2)SC(=S)N1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H13N3O2S3/c25-19-18(12-14-10-11-16(26-14)13-6-2-1-3-7-13)29-21(27)24(19)23-20-22-15-8-4-5-9-17(15)28-20/h1-12H,(H,22,23) |
| InChIKey | VKLKWOCTGNKOCA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|