C22H21N3O3S3 — CID 6197234
(5Z)-3-(1,3-benzothiazol-2-ylamino)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6197234) has the molecular formula C22H21N3O3S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzothiazol-2-ylamino)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,3-benzothiazol-2-ylamino)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6197234 |
| Molecular Formula | C22H21N3O3S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | (5Z)-3-(1,3-benzothiazol-2-ylamino)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccc(/C=C2\SC(=S)N(Nc3nc4ccccc4s3)C2=O)cc1OC |
| InChI | InChI=1S/C22H21N3O3S3/c1-3-4-11-28-16-10-9-14(12-17(16)27-2)13-19-20(26)25(22(29)31-19)24-21-23-15-7-5-6-8-18(15)30-21/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,24)/b19-13- |
| InChIKey | BXZAGZKKQWKBNW-UYRXBGFRSA-N |
| XLogP | 5.71 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|