C18H21NO6S2 — CID 7656407
(2R)-2-[(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxypropanoic acid (PubChem CID 7656407) has the molecular formula C18H21NO6S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 7656407 |
| Molecular Formula | C18H21NO6S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(4-butoxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-hydroxypropanoic acid |
| SMILES | CCCCOc1ccc(/C=C2\SC(=S)N([C@H](CO)C(=O)O)C2=O)cc1OC |
| InChI | InChI=1S/C18H21NO6S2/c1-3-4-7-25-13-6-5-11(8-14(13)24-2)9-15-16(21)19(18(26)27-15)12(10-20)17(22)23/h5-6,8-9,12,20H,3-4,7,10H2,1-2H3,(H,22,23)/b15-9-/t12-/m1/s1 |
| InChIKey | ZCEIYXANMQLPRS-CDCQXCROSA-N |
| XLogP | 2.52 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|