C24H31NO7S2 — CID 98160179
(2R)-2-[(5E)-5-[[3-methoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 98160179) has the molecular formula C24H31NO7S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-[[3-methoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2R)-2-[(5E)-5-[[3-methoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 98160179 |
| Molecular Formula | C24H31NO7S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (2R)-2-[(5E)-5-[[3-methoxy-4-[(2R)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | CCCCCCC[C@@H](C)Oc1ccc(/C=C2/SC(=S)N([C@H](CC(=O)O)C(=O)O)C2=O)cc1OC |
| InChI | InChI=1S/C24H31NO7S2/c1-4-5-6-7-8-9-15(2)32-18-11-10-16(12-19(18)31-3)13-20-22(28)25(24(33)34-20)17(23(29)30)14-21(26)27/h10-13,15,17H,4-9,14H2,1-3H3,(H,26,27)(H,29,30)/b20-13+/t15-,17-/m1/s1 |
| InChIKey | BUIXKZJJJUVVIA-GUTWODCUSA-N |
| XLogP | 4.95 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|