C24H33NO5S2 — CID 98160227
(2R)-2-[(5E)-5-[[3-ethoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 98160227) has the molecular formula C24H33NO5S2 and a molecular weight of 479.66 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-[[3-ethoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | (2R)-2-[(5E)-5-[[3-ethoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 98160227 |
| Molecular Formula | C24H33NO5S2 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (2R)-2-[(5E)-5-[[3-ethoxy-4-[(2S)-nonan-2-yl]oxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCCCCCC[C@H](C)Oc1ccc(/C=C2/SC(=S)N([C@H](C)C(=O)O)C2=O)cc1OCC |
| InChI | InChI=1S/C24H33NO5S2/c1-5-7-8-9-10-11-16(3)30-19-13-12-18(14-20(19)29-6-2)15-21-22(26)25(24(31)32-21)17(4)23(27)28/h12-17H,5-11H2,1-4H3,(H,27,28)/b21-15+/t16-,17+/m0/s1 |
| InChIKey | FCRSZSWBAMRKOA-NCHNDMATSA-N |
| XLogP | 5.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|