C25H35NO5S2 — CID 6531926
4-[(5E)-5-[(3-ethoxy-4-nonan-2-yloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 6531926) has the molecular formula C25H35NO5S2 and a molecular weight of 493.69 g/mol. Its IUPAC name is 4-[(5E)-5-[(3-ethoxy-4-nonan-2-yloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[(3-ethoxy-4-nonan-2-yloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 6531926 |
| Molecular Formula | C25H35NO5S2 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-[(5E)-5-[(3-ethoxy-4-nonan-2-yloxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CCCCCCCC(C)Oc1ccc(/C=C2/SC(=S)N(CCCC(=O)O)C2=O)cc1OCC |
| InChI | InChI=1S/C25H35NO5S2/c1-4-6-7-8-9-11-18(3)31-20-14-13-19(16-21(20)30-5-2)17-22-24(29)26(25(32)33-22)15-10-12-23(27)28/h13-14,16-18H,4-12,15H2,1-3H3,(H,27,28)/b22-17+ |
| InChIKey | LVZMAEIWGUQKMF-OQKWZONESA-N |
| XLogP | 6.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|